Valperinol

Valperinol (INN; GA 30-905) is a drug which acts as a calcium channel blocker.[1][2] It was patented as a possible sedative, antiepileptic, and/or antiparkinsonian agent, but was never marketed.[3]

Valperinol

Clinical data
ATC code	None
Legal status
Legal status	In general: non-regulated
Identifiers
IUPAC name (1R,3R,4S,6R,7S,8R,10R)-8-methoxy-10-methyl-3-(1-piperidinylmethyl)-2,9-dioxatricyclo[4.3.1.0^3,7]decan-4-ol
CAS Number	64860-67-9
PubChem CID	68849
ChemSpider	62082
Chemical and physical data
Formula	C16H27NO4
Molar mass	297.395 g·mol^−1
3D model (JSmol)	Interactive image
SMILES O1[C@@H](OC)[C@@H]2[C@@]3(O[C@H]1[C@@H]([C@H]2C[C@@H]3O)C)CN4CCCCC4
InChI InChI=1S/C16H27NO4/c1-10-11-8-12(18)16(9-17-6-4-3-5-7-17)13(11)15(19-2)20-14(10)21-16/h10-15,18H,3-9H2,1-2H3/t10-,11-,12+,13-,14+,15-,16-/m1/s1 Key:KZSHXABWNBVUTK-GBIHRFPISA-N

References

1. Thies PW, Asai A, Bán I, David S, Finner E (1984). "[The synthesis of valperinol and various 3-aminomethyl derivatives of 2,9-dioxatricyclo[4,3,1,0(3,7)]decane from didrovaltrate]". Arzneimittel-Forschung (in German). 34 (11): 1460–3. PMID 6543120.
2. Dose M (1984). "[Calcium antagonist properties of valperinol]". Arzneimittel-Forschung (in German). 34 (11): 1464–6. PMID 6098282.
3. Dictionary of Pharmacological Agents Volume 2. CRC Press. 1996-11-21. p. 2104. ISBN 978-0-412-46630-4. Retrieved 22 April 2012.