N-Methylmaleimide

N-Methylmaleimide
Identifiers
CAS Number	930-88-1 ;
3D model (JSmol)	Interactive image;
ChemSpider	63446;
ECHA InfoCard	100.012.024
EC Number	213-226-1;
PubChem CID	70261;
UNII	P0TFZ8R21Y ;
CompTox Dashboard (EPA)	DTXSID30239240 ;
	InChI InChI=1S/C5H5NO2/c1-6-4(7)2-3-5(6)8/h2-3H,1H3 Key: SEEYREPSKCQBBF-UHFFFAOYSA-N; InChI=1/C5H5NO2/c1-6-4(7)2-3-5(6)8/h2-3H,1H3 Key: SEEYREPSKCQBBF-UHFFFAOYAQ;
	SMILES CN1C(=O)C=CC1=O;
Properties
Chemical formula	C5H5NO2
Molar mass	111.100 g·mol−1
Melting point	94 to 96 °C (201 to 205 °F; 367 to 369 K)
	Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
	verify (what is ?)
	Infobox references

N-Methylmaleimide is a naturally-occurring organic compound with the formula of C₅H₅NO₂.

Spectrum

1H NMR spectrum for N-methylmaleimide

gollark: Now, part of that is probably that you can't really trust whoever is asking to use those resources properly, and that's fair. But there are now things for comparing the effectiveness of different charities and whatnot.

gollark: But if you ask "hey, random person, would you be willing to give up some amount of money/resources/etc to stop people dying of malaria", people will just mostly say no.

gollark: If you *ask* someone "hey, random person, would you like people in Africa to not die of malaria", they will obviously say yes. Abstractly speaking, people don't want people elsewhere to die of malaria.

gollark: Capitalism is why we have a massively effective (okay, mostly, some things are bad and need fixing, like intellectual property) economic engine here which can produce tons of stuff people want. But people *do not care* about diverting that to help faraway people they can't see.

gollark: Helping people elsewhere does mean somewhat fewer resources available here, and broadly speaking people do not actually want to make that tradeoff.

References

This article is issued from Wikipedia. The text is licensed under Creative Commons - Attribution - Sharealike. Additional terms may apply for the media files.