Raltitrexed

{{Drugbox | verifiedrevid = 464379925 | IUPAC_name = N-[(5-{methyl[(2-methyl-4-oxo-1,4-dihydroquinazolin-6-yl)methyl]amino}-2-thienyl)carbonyl]-L-glutamic acid | image = Raltitrexed.svg | image2 = Raltitrexed ball-and-stick.png | tradename = | Drugs.com = Micromedex Detailed Consumer Information | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_UK = POM | legal_US = Not available | legal_status = | routes_of_administration = Intravenous | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | IUPHAR_ligand = 7403 | CAS_number_Ref =  Y | CAS_number = 112887-68-0 | ATC_prefix = L01 | ATC_suffix = BA03 | ATC_supplemental = | PubChem = 104758 | DrugBank_Ref =  Y | DrugBank = DB00293 | ChemSpiderID_Ref =  Y | ChemSpiderID = 94568 | UNII_Ref =  Y | UNII = FCB9EGG971 | KEGG_Ref =  Y | KEGG = D01064 | ChEMBL_Ref =  Y | ChEMBL = 225071 | PDB_ligand = D16 | C=21 | H=22 | N=4 | O=6 | S=1 | smiles = O=C(c3sc(N(C)Cc2cc1C(=O)\N=C(/Nc1cc2)C)cc3)N[C@H](C(=O)O)CCC(=O)O | StdInChI_Ref =  Y | StdInChI = 1S/C21H22N4O6S/c1-11-22-14-4-3-12(9-13(14)19(28)23-11)10-25(2)17-7-6-16(32-17)20(29)24-15(21(30)31)5-8-18(26)27/h3-4,6-7,9,15H,5,8,10H2,1-2H3,(H,24,29)(H,26,27)(H,30,31)(H,22,23,28)/t15-/m0/s1 | StdInChIKey_Ref =  Y | StdInChIKey = IVTVGDXNLFLDRM-HNNXBMFYSA-N }}

Raltitrexed (Tomudex, TDX, ZD 1694) is an antimetabolite drug used in cancer chemotherapy. It is an inhibitor of thymidylate synthase, and is manufactured by AstraZeneca.[1]

Uses

Used in treatment of colorectal cancer since 1998, it may also be used in the treatment of malignant mesothelioma.[2] Raltitrexed is approved for use in Canada and some European countries, but is not approved by the US FDA.[3][4]

Mechanism of action

Raltitrexed is chemically similar to folic acid and is in the class of chemotherapy drugs called folate antimetabolites, which inhibit one or more of three enzymes that use folate and derivatives as substrates: DHFR, GARFT and thymidylate synthase. Raltitrexed is fully active after polyglutamylation, which allows cellular retention of the drug.

By inhibiting Thymidylate synthase (TS), thus formation of precursor pyrimidine nucleotides, raltitrexed prevents the formation of DNA and RNA, which are required for the growth and survival of both normal cells and cancer cells.

Inhibition of L1210 cell growth in culture IC50 = 9 nM, is one of the strongest antimetabolites in use.

Structure and phase I clinical trial of the precursor drug, CB3717, was described in 1986.[5]

gollark: There are* applications.
gollark: My multicast chat thing is basically a chat program which works by sending your messages to a multicast group.
gollark: Anyway, multicast is a thing where you can broadcast packets to multiple other devices, mostly over LANs.
gollark: Flickery isn't right, it just... works weirdly somehow?
gollark: I use some random library for it since curses is æ.

References

This article is issued from Wikipedia. The text is licensed under Creative Commons - Attribution - Sharealike. Additional terms may apply for the media files.