Tabersonine

Tabersonine is a terpene indole alkaloid found in the medicinal plant Catharanthus roseus. Tabersonine is hydroxylated at the 16 position by the enzyme tabersonine 16-hydroxylase (T16H) to form 16-hydroxytabersonine.[1] The enzyme leading to its formation is currently unknown. Tabersonine is the first intermediate leading to the formation of vindoline one of the two precursors required for vinblastine biosynthesis.

Tabersonine

Names
IUPAC name Methyl (5α,12β,19α)-2,3,6,7-tetradehydroaspidospermidine-3-carboxylate
Identifiers
CAS Number	29479-00-3
3D model (JSmol)	Interactive image
ChemSpider	19292
ECHA InfoCard	100.022.378
PubChem CID	20485
CompTox Dashboard (EPA)	DTXSID30196102
InChI InChI=1S/C21H24N2O2/c1-3-20-9-6-11-23-12-10-21(19(20)23)15-7-4-5-8-16(15)22-17(21)14(13-20)18(24)25-2/h4-9,19,22H,3,10-13H2,1-2H3/t19-,20-,21-/m0/s1 Key: FNGGIPWAZSFKCN-ACRUOGEOSA-N InChI=1/C21H24N2O2/c1-3-20-9-6-11-23-12-10-21(19(20)23)15-7-4-5-8-16(15)22-17(21)14(13-20)18(24)25-2/h4-9,19,22H,3,10-13H2,1-2H3/t19-,20-,21-/m0/s1 Key: FNGGIPWAZSFKCN-ACRUOGEOBF
SMILES CC[C@]12CC(=C3[C@@]4([C@H]1N(CC4)CC=C2)c5ccccc5N3)C(=O)OC
Properties
Chemical formula	C21H24N2O2
Molar mass	336.435 g·mol^−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references

References

1. St-Pierre and De Luca (1995) A Cytochrome P-450 Monooxygenase Catalyzes the First Step in the Conversion of Tabersonine to Vindoline in Catharanthus roseus. Plant Physiology. 109(1). 131-139