Iodobenzamide

Iodobenzamide (IBZM or iolopride) is a chemical substance. Pharmaceutically it is a dopamine antagonist and it can be used by nuclear medicine physicians as a radioactive tracer for SPECT where the radioactive isotope is iodine-123 or iodine-125.[1][2] The main purpose of a brain study with IBZM is the differentiation of Parkinson's disease from other neurodegenerative diseases such as Lewy Body dementia and multiple system atrophy.

Iodobenzamide

Names
IUPAC name N-{[(2S)-1-Ethylpyrrolidin-2-yl]methyl}-2-hydroxy-3-iodo-6-methoxybenzamide
Other names IBZM; Iolopride
Identifiers
CAS Number	84226-06-2^Y 113716-48-6 (^123I)^Y 113452-80-5 (^125I)^Y
3D model (JSmol)	Interactive image
ChemSpider	^123I).html 97107(^123I)
PubChem CID	107995
UNII	9J5D4ZN1JK^Y 5E76SOQ99K (^123I)^Y 0709QG1NOY (^125I)^Y
InChI InChI=1S/C15H21IN2O3/c1-3-18-8-4-5-10(18)9-17-15(20)13-12(21-2)7-6-11(16)14(13)19/h6-7,10,19H,3-5,8-9H2,1-2H3,(H,17,20)/t10-/m0/s1 Key: CANPFCFJURGKAX-JTQLQIEISA-N InChI=1/C15H21IN2O3/c1-3-18-8-4-5-10(18)9-17-15(20)13-12(21-2)7-6-11(16)14(13)19/h6-7,10,19H,3-5,8-9H2,1-2H3,(H,17,20)/t10-/m0/s1 Key: CANPFCFJURGKAX-JTQLQIEIBE
SMILES Ic1ccc(OC)c(c1O)C(=O)NC[C@H]2N(CC)CCC2
Properties
Chemical formula	C15H21IN2O3
Molar mass	404.248 g·mol^−1
Pharmacology
ATC code	V09AB02 (WHO)
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references

References

1. Kung, H. F.; Guo, Y. Z.; Billings, J.; Xu, X.; Mach, R. H.; Blau, M.; Ackerhalt, R. E. (1988). "Preparation and biodistribution of [125I]IBZM: a potential CNS D-2 dopamine receptor imaging agent". Nuclear Medicine and Biology. 15 (2): 195–201. doi:10.1016/0883-2897(88)90088-8. PMID 2966782.
2. Kung, Hank, F.; Alavi; Chang; Kung; Keyes; Velchik; Billings; Pan; Noto (1990). "In vivo SPECT imaging of CNS D-2 dopamine receptors: initial studies with iodine-123-IBZM in humans". Journal of Nuclear Medicine. 31 (5): 573–579. PMID 2140408.CS1 maint: multiple names: authors list (link)