Hypoglycin B

Hypoglycin B is a naturally occurring organic compound in the species Blighia sapida. It is particularly concentrated in the fruit of the plant especially in the seeds. Hypoglycin B is toxic if ingested and is one of the causative agents of Jamaican vomiting sickness.[1] It is a dipeptide of glutamic acid and hypoglycin A.

Hypoglycin B

Names
IUPAC name (2S)-2-Amino-4-(1S)-1-carboxy-2-[(1S)-2-methylidenecyclopropyl]ethyl]carbamoyl]butanoic acid
Other names L-γ-Glutamyl-L-hypoglycin; L-γ-Glutamyl-3-[(1S)-2-methylenecyclopropyl]-L-alanine
Identifiers
CAS Number	502-37-4^Y
3D model (JSmol)	Interactive image
ChemSpider	390178^Y
PubChem CID	441445
UNII	T83F0X4NGN^Y
CompTox Dashboard (EPA)	DTXSID10894992
InChI InChI=1S/C12H18N2O5/c1-6-4-7(6)5-9(12(18)19)14-10(15)3-2-8(13)11(16)17/h7-9H,1-5,13H2,(H,14,15)(H,16,17)(H,18,19)/t7-,8-,9-/m0/s1^Y Key: UYDZYCPIQSRXKU-CIUDSAMLSA-N^Y InChI=1/C12H18N2O5/c1-6-4-7(6)5-9(12(18)19)14-10(15)3-2-8(13)11(16)17/h7-9H,1-5,13H2,(H,14,15)(H,16,17)(H,18,19)/t7-,8-,9-/m0/s1 Key: UYDZYCPIQSRXKU-CIUDSAMLBD
SMILES O=C(N[C@H](C(=O)O)C[C@H]1C(=C)C1)CC[C@@H](C(=O)O)N
Properties
Chemical formula	C12H18N2O5
Molar mass	270.285 g·mol^−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Y verify (what is ^YN ?)
Infobox references

References

1. "Ackee Fruit Toxicity". Medscape.