Xylonic acid

Xylonic acid is a sugar acid that can be obtained by oxidation of the hemiacetal/aldehyde group of xylose.[1][2][3] The C-2 epimer is known as lyxonic acid.

d-Xylonic acid

Names
IUPAC name (2R,3S,4R)-2,3,4,5-tetrahydroxypentanoic acid
Other names Xylonate
Identifiers
CAS Number	17828-56-7 (d/l)^Y 526-91-0 (d)^N 4172-44-5 (l>)^N
3D model (JSmol)	Interactive image
ChEBI	CHEBI:48093 (d) CHEBI:48092 (l)
ChemSpider	5034782^N
PubChem CID	6602431
InChI InChI=1S/C5H10O6/c6-1-2(7)3(8)4(9)5(10)11/h2-4,6-9H,1H2,(H,10,11)/t2-,3+,4-/m1/s1^N Key: QXKAIJAYHKCRRA-FLRLBIABSA-N^N InChI=1/C5H10O6/c6-1-2(7)3(8)4(9)5(10)11/h2-4,6-9H,1H2,(H,10,11)/t2-,3+,4-/m1/s1 Key: QXKAIJAYHKCRRA-FLRLBIABBX
SMILES C([C@H]([C@@H]([C@H](C(=O)O)O)O)O)O
Properties
Chemical formula	C 5H 10O 6
Molar mass	166.13 g/mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
N verify (what is ^YN ?)
Infobox references

References

1. PubChem. "L-Xylonic acid". pubchem.ncbi.nlm.nih.gov. Retrieved 2019-06-02.
2. "D-Xylonic acid | C5H10O6 | ChemSpider". www.chemspider.com. Retrieved 2019-06-02.
3. "XYLONIC ACID | Sigma-Aldrich". www.sigmaaldrich.com. Retrieved 2019-06-02.