Antrocamphin B

Antrocamphin B is a bioactive isolate of Taiwanofungus camphoratus.[1] Antrocamphin B is a congener of antrocamphin A.[2]

Antrocamphin B

Names
IUPAC name 4-(3,4,6-Trimethoxy-2-methylphenyl)but-3-yn-2-one
Identifiers
3D model (JSmol)	Interactive image
ChemSpider	20568908
PubChem CID	16737473
InChI InChI=1S/C14H16O4/c1-9(15)6-7-11-10(2)14(18-5)13(17-4)8-12(11)16-3/h8H,1-5H3 Key: IKGSJDIGQRJKDN-UHFFFAOYSA-N
SMILES CC1=C(C(=CC(=C1OC)OC)OC)C#CC(=O)C
Properties
Chemical formula	C14H16O4
Molar mass	248.278 g·mol^−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references

References

1. Buccini M, Punch KA, Kaskow B, et al. (February 2014). "Ethynylbenzenoid metabolites of Antrodia camphorata: synthesis and inhibition of TNF expression". Org. Biomol. Chem. 12 (7): 1100–13. doi:10.1039/c3ob42333f. PMID 24385001.
2. Buccini M, Punch KA, Kaskow B, Flematti GR, Skelton BW, Abraham LJ, et al. (2014). "Ethynylbenzenoid metabolites of Antrodia camphorata: synthesis and inhibition of TNF expression". Org Biomol Chem. 12 (7): 1100–13. doi:10.1039/c3ob42333f. PMID 24385001.