Piperidylthiambutene

Piperidylthiambutene (Piperidinohton) is an opioid analgesic drug from the thiambutene family, which has around the same potency as morphine.[1][2][3] If sold or obtained for the purpose of human consumption it could be considered a controlled substance analogue in some countries such as the US, Australia and New Zealand. Piperidylthiambutene has been sold as a designer drug, first appearing in late 2018.[4]

Piperidylthiambutene

Clinical data
ATC code	none
Identifiers
IUPAC name 1-[4,4-Di(thiophen-2-yl)but-3-en-2-yl]piperidine
CAS Number	54160-31-5^Y
PubChem CID	3041503
ChemSpider	2304772
UNII	4BU0BCP2E1
Chemical and physical data
Formula	C17H21NS2
Molar mass	303.48 g·mol^−1
3D model (JSmol)	Interactive image
Melting point	188 to 189 °C (370 to 372 °F)
SMILES C1CCCCN1C(C)C=C(c3cccs3)c2sccc2
InChI InChI=1S/C17H21NS2/c1-14(18-9-3-2-4-10-18)13-15(16-7-5-11-19-16)17-8-6-12-20-17/h5-8,11-14H,2-4,9-10H2,1H3 Key:FQRWJLVMJCKSME-UHFFFAOYSA-N
(verify)

References

1. Adamson DW, Green AF (January 1950). "A new series of analgesics". Nature. 165 (4186): 122. Bibcode:1950Natur.165..122A. doi:10.1038/165122a0. PMID 15409854.
2. Adamson DW, Duffin WM, Green AF (January 1951). "Dithienylbutylamines as analgesics". Nature. 167 (4239): 153–4. Bibcode:1951Natur.167..153A. doi:10.1038/167153b0. PMID 14806409.
3. Green AF (March 1953). "Analgesic and other properties of 3: 3-dithienylalkenylamines". British Journal of Pharmacology and Chemotherapy. 8 (1): 2–9. doi:10.1111/j.1476-5381.1953.tb00739.x. PMC 1509239. PMID 13066683.
4. "Analytical report Piperidylthiambutene" (PDF). European Project Response. November 2018.